About 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride
6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride (PubChem CID 175462374) has the molecular formula C14H11ClN3O2PS2
and a molecular weight of 383.82 g/mol. Its IUPAC name is 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride |
| PubChem CID | 175462374 |
| Molecular Formula | C14H11ClN3O2PS2 |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.NP(Oc1ccc2ncsc2c1)Oc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H10N3O2PS2.ClH/c15-20(18-9-1-3-11-13(5-9)21-7-16-11)19-10-2-4-12-14(6-10)22-8-17-12;/h1-8H,15H2;1H |
| InChIKey | SZXIHFDVDXACBH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride?
The IUPAC name of 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride (CID 175462374) is 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride is Cl.NP(Oc1ccc2ncsc2c1)Oc1ccc2ncsc2c1.
What is the InChIKey of 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride?
The InChIKey is SZXIHFDVDXACBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N3O2PS2.ClH/c15-20(18-9-1-3-11-13(5-9)21-7-16-11)19-10-2-4-12-14(6-10)22-8-17-12;/h1-8H,15H2;1H.
What are the key properties of 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride?
6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride has a molecular weight of 383.82 g/mol, XLogP of 4.97, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 175462374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).