C14H11ClN3O2PS2 — CID 175462374
6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride (PubChem CID 175462374) has the molecular formula C14H11ClN3O2PS2 and a molecular weight of 383.82 g/mol. Its IUPAC name is 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride.
| Compound Name | 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride |
|---|---|
| PubChem CID | 175462374 |
| Molecular Formula | C14H11ClN3O2PS2 |
| Molecular Weight | 383.82 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 6-[amino(1,3-benzothiazol-6-yloxy)phosphanyl]oxy-1,3-benzothiazole;hydrochloride |
| SMILES | Cl.NP(Oc1ccc2ncsc2c1)Oc1ccc2ncsc2c1 |
| InChI | InChI=1S/C14H10N3O2PS2.ClH/c15-20(18-9-1-3-11-13(5-9)21-7-16-11)19-10-2-4-12-14(6-10)22-8-17-12;/h1-8H,15H2;1H |
| InChIKey | SZXIHFDVDXACBH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.82 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|