C10H12N2S — CID 69250616
3-(1,3-benzothiazol-6-yl)propan-1-amine (PubChem CID 69250616) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)propan-1-amine.
| Compound Name | 3-(1,3-benzothiazol-6-yl)propan-1-amine |
|---|---|
| PubChem CID | 69250616 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)propan-1-amine |
| SMILES | NCCCc1ccc2ncsc2c1 |
| InChI | InChI=1S/C10H12N2S/c11-5-1-2-8-3-4-9-10(6-8)13-7-12-9/h3-4,6-7H,1-2,5,11H2 |
| InChIKey | VODGZZWQRMPOOH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |