C8H9ClN2S — CID 133063605
1,3-benzothiazol-6-ylmethanamine;hydrochloride (PubChem CID 133063605) has the molecular formula C8H9ClN2S and a molecular weight of 200.69 g/mol. Its IUPAC name is 1,3-benzothiazol-6-ylmethanamine;hydrochloride.
| Compound Name | 1,3-benzothiazol-6-ylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 133063605 |
| Molecular Formula | C8H9ClN2S |
| Molecular Weight | 200.69 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 1,3-benzothiazol-6-ylmethanamine;hydrochloride |
| SMILES | Cl.NCc1ccc2ncsc2c1 |
| InChI | InChI=1S/C8H8N2S.ClH/c9-4-6-1-2-7-8(3-6)11-5-10-7;/h1-3,5H,4,9H2;1H |
| InChIKey | PVKQIXDKXJWXEG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.69 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |