C11H9N3S2 — CID 107800290
5-(1,3-benzothiazol-6-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 107800290) has the molecular formula C11H9N3S2 and a molecular weight of 247.35 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-6-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 5-(1,3-benzothiazol-6-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 107800290 |
| Molecular Formula | C11H9N3S2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 5-(1,3-benzothiazol-6-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Nc1ncc(Cc2ccc3ncsc3c2)s1 |
| InChI | InChI=1S/C11H9N3S2/c12-11-13-5-8(16-11)3-7-1-2-9-10(4-7)15-6-14-9/h1-2,4-6H,3H2,(H2,12,13) |
| InChIKey | LTAWNBYALRWIOI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |