C16H17N3OS — CID 170867715
3-[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]propan-1-amine (PubChem CID 170867715) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]propan-1-amine.
| Compound Name | 3-[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 170867715 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]propan-1-amine |
| SMILES | NCCCc1ccc(OCc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C16H17N3OS/c17-9-1-2-12-3-6-14(7-4-12)20-11-13-5-8-15-16(10-13)19-21-18-15/h3-8,10H,1-2,9,11,17H2 |
| InChIKey | CJNKJKGXSOBZQN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |