C20H16N2O5S — CID 168598764
5-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 168598764) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is 5-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598764 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 5-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(OCc3ccc4nsnc4c3)cc2)C(=O)O1 |
| InChI | InChI=1S/C20H16N2O5S/c1-20(2)26-18(23)15(19(24)27-20)9-12-3-6-14(7-4-12)25-11-13-5-8-16-17(10-13)22-28-21-16/h3-10H,11H2,1-2H3 |
| InChIKey | JHARLIGGLHECNQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|