C16H18O4 — CID 168598319
2,2-dimethyl-5-[(4-propylphenyl)methylidene]-1,3-dioxane-4,6-dione (PubChem CID 168598319) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2,2-dimethyl-5-[(4-propylphenyl)methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[(4-propylphenyl)methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 168598319 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2,2-dimethyl-5-[(4-propylphenyl)methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CCCc1ccc(C=C2C(=O)OC(C)(C)OC2=O)cc1 |
| InChI | InChI=1S/C16H18O4/c1-4-5-11-6-8-12(9-7-11)10-13-14(17)19-16(2,3)20-15(13)18/h6-10H,4-5H2,1-3H3 |
| InChIKey | GMHVOYXGDTVUMJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|