C19H23BO6 — CID 71306554
2,2-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione (PubChem CID 71306554) has the molecular formula C19H23BO6 and a molecular weight of 358.20 g/mol. Its IUPAC name is 2,2-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 71306554 |
| Molecular Formula | C19H23BO6 |
| Molecular Weight | 358.20 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2,2-dimethyl-5-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylidene]-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(=Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)O1 |
| InChI | InChI=1S/C19H23BO6/c1-17(2)18(3,4)26-20(25-17)13-9-7-12(8-10-13)11-14-15(21)23-19(5,6)24-16(14)22/h7-11H,1-6H3 |
| InChIKey | FJXDGPRVRQBGAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.20 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|