C15H14N6OS — CID 168591455
2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylideneamino]guanidine (PubChem CID 168591455) has the molecular formula C15H14N6OS and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylideneamino]guanidine.
| Compound Name | 2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 168591455 |
| Molecular Formula | C15H14N6OS |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[[4-(2,1,3-benzothiadiazol-5-ylmethoxy)phenyl]methylideneamino]guanidine |
| SMILES | NC(N)=NN=Cc1ccc(OCc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C15H14N6OS/c16-15(17)19-18-8-10-1-4-12(5-2-10)22-9-11-3-6-13-14(7-11)21-23-20-13/h1-8H,9H2,(H4,16,17,19) |
| InChIKey | GXTGTHQJQSSDFM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|