About 6-methoxy-1,3-benzothiazole;toluene
6-methoxy-1,3-benzothiazole;toluene (PubChem CID 70544898) has the molecular formula C15H15NOS
and a molecular weight of 257.36 g/mol. Its IUPAC name is 6-methoxy-1,3-benzothiazole;toluene.
Molecular Properties
| Compound Name | 6-methoxy-1,3-benzothiazole;toluene |
| PubChem CID | 70544898 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 6-methoxy-1,3-benzothiazole;toluene |
| SMILES | COc1ccc2ncsc2c1.Cc1ccccc1 |
| InChI | InChI=1S/C8H7NOS.C7H8/c1-10-6-2-3-7-8(4-6)11-5-9-7;1-7-5-3-2-4-6-7/h2-5H,1H3;2-6H,1H3 |
| InChIKey | OXEGXWSEIGXBAD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methoxy-1,3-benzothiazole;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-1,3-benzothiazole;toluene?
The IUPAC name of 6-methoxy-1,3-benzothiazole;toluene (CID 70544898) is 6-methoxy-1,3-benzothiazole;toluene.
What is the SMILES notation for 6-methoxy-1,3-benzothiazole;toluene?
The canonical SMILES for 6-methoxy-1,3-benzothiazole;toluene is COc1ccc2ncsc2c1.Cc1ccccc1.
What is the InChIKey of 6-methoxy-1,3-benzothiazole;toluene?
The InChIKey is OXEGXWSEIGXBAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NOS.C7H8/c1-10-6-2-3-7-8(4-6)11-5-9-7;1-7-5-3-2-4-6-7/h2-5H,1H3;2-6H,1H3.
What are the key properties of 6-methoxy-1,3-benzothiazole;toluene?
6-methoxy-1,3-benzothiazole;toluene has a molecular weight of 257.36 g/mol, XLogP of 4.30, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-1,3-benzothiazole;toluene is sourced from PubChem (CID 70544898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).