C15H15NOS — CID 70544898
6-methoxy-1,3-benzothiazole;toluene (PubChem CID 70544898) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is 6-methoxy-1,3-benzothiazole;toluene.
| Compound Name | 6-methoxy-1,3-benzothiazole;toluene |
|---|---|
| PubChem CID | 70544898 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 6-methoxy-1,3-benzothiazole;toluene |
| SMILES | COc1ccc2ncsc2c1.Cc1ccccc1 |
| InChI | InChI=1S/C8H7NOS.C7H8/c1-10-6-2-3-7-8(4-6)11-5-9-7;1-7-5-3-2-4-6-7/h2-5H,1H3;2-6H,1H3 |
| InChIKey | OXEGXWSEIGXBAD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |