C14H12N2O3S2 — CID 23275795
6-phenylmethoxy-1,3-benzothiazole-2-sulfonamide (PubChem CID 23275795) has the molecular formula C14H12N2O3S2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-phenylmethoxy-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 6-phenylmethoxy-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 23275795 |
| Molecular Formula | C14H12N2O3S2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 6-phenylmethoxy-1,3-benzothiazole-2-sulfonamide |
| SMILES | NS(=O)(=O)c1nc2ccc(OCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C14H12N2O3S2/c15-21(17,18)14-16-12-7-6-11(8-13(12)20-14)19-9-10-4-2-1-3-5-10/h1-8H,9H2,(H2,15,17,18) |
| InChIKey | NKRUDBUTVFONMV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |