C9H10N2O3S2 — CID 3295
6-ethoxy-1,3-benzothiazole-2-sulfonamide (PubChem CID 3295) has the molecular formula C9H10N2O3S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 6-ethoxy-1,3-benzothiazole-2-sulfonamide.
| Compound Name | 6-ethoxy-1,3-benzothiazole-2-sulfonamide |
|---|---|
| PubChem CID | 3295 |
| Molecular Formula | C9H10N2O3S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | 6-ethoxy-1,3-benzothiazole-2-sulfonamide |
| SMILES | CCOc1ccc2nc(S(N)(=O)=O)sc2c1 |
| InChI | InChI=1S/C9H10N2O3S2/c1-2-14-6-3-4-7-8(5-6)15-9(11-7)16(10,12)13/h3-5H,2H2,1H3,(H2,10,12,13) |
| InChIKey | OUZWUKMCLIBBOG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |