C15H14N2O3S2 — CID 2118309
2-methoxy-N-(2-methyl-1,3-benzothiazol-6-yl)benzenesulfonamide (PubChem CID 2118309) has the molecular formula C15H14N2O3S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-methoxy-N-(2-methyl-1,3-benzothiazol-6-yl)benzenesulfonamide.
| Compound Name | 2-methoxy-N-(2-methyl-1,3-benzothiazol-6-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 2118309 |
| Molecular Formula | C15H14N2O3S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-methoxy-N-(2-methyl-1,3-benzothiazol-6-yl)benzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)Nc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C15H14N2O3S2/c1-10-16-12-8-7-11(9-14(12)21-10)17-22(18,19)15-6-4-3-5-13(15)20-2/h3-9,17H,1-2H3 |
| InChIKey | MOHNKWXAYBPWCP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |