C17H18N2O2S2 — CID 59018198
N-(2-methyl-1,3-benzothiazol-6-yl)-4-propylbenzenesulfonamide (PubChem CID 59018198) has the molecular formula C17H18N2O2S2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-4-propylbenzenesulfonamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-4-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 59018198 |
| Molecular Formula | C17H18N2O2S2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-4-propylbenzenesulfonamide |
| SMILES | CCCc1ccc(S(=O)(=O)Nc2ccc3nc(C)sc3c2)cc1 |
| InChI | InChI=1S/C17H18N2O2S2/c1-3-4-13-5-8-15(9-6-13)23(20,21)19-14-7-10-16-17(11-14)22-12(2)18-16/h5-11,19H,3-4H2,1-2H3 |
| InChIKey | DCXSWFPUAQFTRG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |