C16H15N3O4S2 — CID 71915018
N-(2-methyl-1,3-benzothiazol-6-yl)-2-(4-nitrophenyl)ethanesulfonamide (PubChem CID 71915018) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-2-(4-nitrophenyl)ethanesulfonamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-(4-nitrophenyl)ethanesulfonamide |
|---|---|
| PubChem CID | 71915018 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-(4-nitrophenyl)ethanesulfonamide |
| SMILES | Cc1nc2ccc(NS(=O)(=O)CCc3ccc([N+](=O)[O-])cc3)cc2s1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-11-17-15-7-4-13(10-16(15)24-11)18-25(22,23)9-8-12-2-5-14(6-3-12)19(20)21/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | OHDBWMCSGHACAG-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|