C8H6ClN3O4S2 — CID 63665732
1-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)methanesulfonamide (PubChem CID 63665732) has the molecular formula C8H6ClN3O4S2 and a molecular weight of 307.74 g/mol. Its IUPAC name is 1-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)methanesulfonamide.
| Compound Name | 1-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 63665732 |
| Molecular Formula | C8H6ClN3O4S2 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 306.95 |
| IUPAC Name | 1-chloro-N-(6-nitro-1,3-benzothiazol-2-yl)methanesulfonamide |
| SMILES | O=[N+]([O-])c1ccc2nc(NS(=O)(=O)CCl)sc2c1 |
| InChI | InChI=1S/C8H6ClN3O4S2/c9-4-18(15,16)11-8-10-6-2-1-5(12(13)14)3-7(6)17-8/h1-3H,4H2,(H,10,11) |
| InChIKey | FIMPSAYUAKXEJO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|