C17H18N4O4S2 — CID 56575093
2,5-dimethyl-N-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]benzenesulfonamide (PubChem CID 56575093) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 56575093 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 2,5-dimethyl-N-[2-[(6-nitro-1,3-benzothiazol-2-yl)amino]ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNc2nc3ccc([N+](=O)[O-])cc3s2)c1 |
| InChI | InChI=1S/C17H18N4O4S2/c1-11-3-4-12(2)16(9-11)27(24,25)19-8-7-18-17-20-14-6-5-13(21(22)23)10-15(14)26-17/h3-6,9-10,19H,7-8H2,1-2H3,(H,18,20) |
| InChIKey | LZZJZRZWDLIUFD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|