C17H18N4O2S — CID 56575945
N,N-dimethyl-N'-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylethane-1,2-diamine (PubChem CID 56575945) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is N,N-dimethyl-N'-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylethane-1,2-diamine.
| Compound Name | N,N-dimethyl-N'-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 56575945 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | N,N-dimethyl-N'-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylethane-1,2-diamine |
| SMILES | CN(C)C(CNc1nc2ccc([N+](=O)[O-])cc2s1)c1ccccc1 |
| InChI | InChI=1S/C17H18N4O2S/c1-20(2)15(12-6-4-3-5-7-12)11-18-17-19-14-9-8-13(21(22)23)10-16(14)24-17/h3-10,15H,11H2,1-2H3,(H,18,19) |
| InChIKey | XIQZUXGNAUJIBI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|