C16H18ClN3O2 — CID 7834758
(1R)-N'-(2-chloro-4-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 7834758) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is (1R)-N'-(2-chloro-4-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | (1R)-N'-(2-chloro-4-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 7834758 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (1R)-N'-(2-chloro-4-nitrophenyl)-N,N-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CN(C)[C@@H](CNc1ccc([N+](=O)[O-])cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-19(2)16(12-6-4-3-5-7-12)11-18-15-9-8-13(20(21)22)10-14(15)17/h3-10,16,18H,11H2,1-2H3/t16-/m0/s1 |
| InChIKey | FBFCAYIVOWOOGJ-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|