C24H25BrN4O3 — CID 25361593
(2R)-N-(2-bromo-4-nitrophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]-2-phenylacetamide (PubChem CID 25361593) has the molecular formula C24H25BrN4O3 and a molecular weight of 497.39 g/mol. Its IUPAC name is (2R)-N-(2-bromo-4-nitrophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]-2-phenylacetamide.
| Compound Name | (2R)-N-(2-bromo-4-nitrophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]-2-phenylacetamide |
|---|---|
| PubChem CID | 25361593 |
| Molecular Formula | C24H25BrN4O3 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | (2R)-N-(2-bromo-4-nitrophenyl)-2-[[(2S)-2-(dimethylamino)-2-phenylethyl]amino]-2-phenylacetamide |
| SMILES | CN(C)[C@H](CN[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1Br)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25BrN4O3/c1-28(2)22(17-9-5-3-6-10-17)16-26-23(18-11-7-4-8-12-18)24(30)27-21-14-13-19(29(31)32)15-20(21)25/h3-15,22-23,26H,16H2,1-2H3,(H,27,30)/t22-,23-/m1/s1 |
| InChIKey | PIDSRHNJSNUDBH-DHIUTWEWSA-N |
| XLogP | 4.93 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|