C21H13Br3N2O6 — CID 23741453
[2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 3,5-dibromo-2-hydroxybenzoate (PubChem CID 23741453) has the molecular formula C21H13Br3N2O6 and a molecular weight of 629.06 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 3,5-dibromo-2-hydroxybenzoate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 3,5-dibromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 23741453 |
| Molecular Formula | C21H13Br3N2O6 |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 625.83 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 3,5-dibromo-2-hydroxybenzoate |
| SMILES | O=C(OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Br)c1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C21H13Br3N2O6/c22-12-8-14(18(27)16(24)9-12)21(29)32-19(11-4-2-1-3-5-11)20(28)25-17-7-6-13(26(30)31)10-15(17)23/h1-10,19,27H,(H,25,28) |
| InChIKey | RITUYHVKIRWRNM-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|