C21H16BrN3O5S — CID 4616603
[2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-methylsulfanylpyridine-3-carboxylate (PubChem CID 4616603) has the molecular formula C21H16BrN3O5S and a molecular weight of 502.35 g/mol. Its IUPAC name is [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-methylsulfanylpyridine-3-carboxylate.
| Compound Name | [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-methylsulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 4616603 |
| Molecular Formula | C21H16BrN3O5S |
| Molecular Weight | 502.35 g/mol |
| Exact Mass | 501.00 |
| IUPAC Name | [2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-methylsulfanylpyridine-3-carboxylate |
| SMILES | CSc1ncccc1C(=O)OC(C(=O)Nc1ccc([N+](=O)[O-])cc1Br)c1ccccc1 |
| InChI | InChI=1S/C21H16BrN3O5S/c1-31-20-15(8-5-11-23-20)21(27)30-18(13-6-3-2-4-7-13)19(26)24-17-10-9-14(25(28)29)12-16(17)22/h2-12,18H,1H3,(H,24,26) |
| InChIKey | ODFOXUOQYXRQMO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|