C23H16BrN3O6 — CID 42524266
[(1R)-2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 42524266) has the molecular formula C23H16BrN3O6 and a molecular weight of 510.30 g/mol. Its IUPAC name is [(1R)-2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [(1R)-2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 42524266 |
| Molecular Formula | C23H16BrN3O6 |
| Molecular Weight | 510.30 g/mol |
| Exact Mass | 509.02 |
| IUPAC Name | [(1R)-2-(2-bromo-4-nitroanilino)-2-oxo-1-phenylethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)O[C@@H](C(=O)Nc2ccc([N+](=O)[O-])cc2Br)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H16BrN3O6/c24-19-12-17(27(30)31)8-11-20(19)26-23(29)22(16-4-2-1-3-5-16)33-21(28)14-32-18-9-6-15(13-25)7-10-18/h1-12,22H,14H2,(H,26,29)/t22-/m1/s1 |
| InChIKey | XDBITAKWLRGWRO-JOCHJYFZSA-N |
| XLogP | 4.53 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|