C23H17NO4 — CID 23990439
(2-oxo-1,2-diphenylethyl) 2-(4-cyanophenoxy)acetate (PubChem CID 23990439) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-(4-cyanophenoxy)acetate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 23990439 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OC(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H17NO4/c24-15-17-11-13-20(14-12-17)27-16-21(25)28-23(19-9-5-2-6-10-19)22(26)18-7-3-1-4-8-18/h1-14,23H,16H2 |
| InChIKey | HKPROQXXIKABEB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |