C22H17ClO4 — CID 3488846
(2-oxo-1,2-diphenylethyl) 2-(4-chlorophenoxy)acetate (PubChem CID 3488846) has the molecular formula C22H17ClO4 and a molecular weight of 380.83 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 2-(4-chlorophenoxy)acetate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 3488846 |
| Molecular Formula | C22H17ClO4 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 2-(4-chlorophenoxy)acetate |
| SMILES | O=C(COc1ccc(Cl)cc1)OC(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17ClO4/c23-18-11-13-19(14-12-18)26-15-20(24)27-22(17-9-5-2-6-10-17)21(25)16-7-3-1-4-8-16/h1-14,22H,15H2 |
| InChIKey | HFKZWCZUWQQDPN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |