C24H16ClNO5 — CID 126187299
[(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 126187299) has the molecular formula C24H16ClNO5 and a molecular weight of 433.85 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 126187299 |
| Molecular Formula | C24H16ClNO5 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)O[C@H](C(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16ClNO5/c25-17-12-10-16(11-13-17)22(21(28)15-6-2-1-3-7-15)31-20(27)14-26-23(29)18-8-4-5-9-19(18)24(26)30/h1-13,22H,14H2/t22-/m0/s1 |
| InChIKey | YZDBCXUFUNUJFP-QFIPXVFZSA-N |
| XLogP | 4.10 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|