C23H19ClO3 — CID 5023536
[1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-phenylpropanoate (PubChem CID 5023536) has the molecular formula C23H19ClO3 and a molecular weight of 378.86 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-phenylpropanoate.
| Compound Name | [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 5023536 |
| Molecular Formula | C23H19ClO3 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | [1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC(C(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClO3/c24-20-14-12-19(13-15-20)23(22(26)18-9-5-2-6-10-18)27-21(25)16-11-17-7-3-1-4-8-17/h1-10,12-15,23H,11,16H2 |
| InChIKey | WBJGBAKHDXJWJA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |