C24H20ClNO4 — CID 126184580
[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-anilino-4-oxobutanoate (PubChem CID 126184580) has the molecular formula C24H20ClNO4 and a molecular weight of 421.88 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-anilino-4-oxobutanoate.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-anilino-4-oxobutanoate |
|---|---|
| PubChem CID | 126184580 |
| Molecular Formula | C24H20ClNO4 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 4-anilino-4-oxobutanoate |
| SMILES | O=C(CCC(=O)O[C@@H](C(=O)c1ccccc1)c1ccc(Cl)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C24H20ClNO4/c25-19-13-11-18(12-14-19)24(23(29)17-7-3-1-4-8-17)30-22(28)16-15-21(27)26-20-9-5-2-6-10-20/h1-14,24H,15-16H2,(H,26,27)/t24-/m1/s1 |
| InChIKey | MASNBWJKNQUKQS-XMMPIXPASA-N |
| XLogP | 5.23 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |