C36H24Cl2O6 — CID 126186651
bis[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] benzene-1,3-dicarboxylate (PubChem CID 126186651) has the molecular formula C36H24Cl2O6 and a molecular weight of 623.49 g/mol. Its IUPAC name is bis[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] benzene-1,3-dicarboxylate.
| Compound Name | bis[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 126186651 |
| Molecular Formula | C36H24Cl2O6 |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 622.09 |
| IUPAC Name | bis[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] benzene-1,3-dicarboxylate |
| SMILES | O=C(O[C@@H](C(=O)c1ccccc1)c1ccc(Cl)cc1)c1cccc(C(=O)O[C@@H](C(=O)c2ccccc2)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C36H24Cl2O6/c37-29-18-14-25(15-19-29)33(31(39)23-8-3-1-4-9-23)43-35(41)27-12-7-13-28(22-27)36(42)44-34(26-16-20-30(38)21-17-26)32(40)24-10-5-2-6-11-24/h1-22,33-34H/t33-,34-/m1/s1 |
| InChIKey | RVUZRPQJCHHCLY-KKLWWLSJSA-N |
| XLogP | 8.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |