C28H20ClNO4 — CID 126184796
[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-benzamidobenzoate (PubChem CID 126184796) has the molecular formula C28H20ClNO4 and a molecular weight of 469.92 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-benzamidobenzoate.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-benzamidobenzoate |
|---|---|
| PubChem CID | 126184796 |
| Molecular Formula | C28H20ClNO4 |
| Molecular Weight | 469.92 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)O[C@@H](C(=O)c1ccccc1)c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H20ClNO4/c29-22-17-15-20(16-18-22)26(25(31)19-9-3-1-4-10-19)34-28(33)23-13-7-8-14-24(23)30-27(32)21-11-5-2-6-12-21/h1-18,26H,(H,30,32)/t26-/m1/s1 |
| InChIKey | KQEVHVBYRYVIMC-AREMUKBSSA-N |
| XLogP | 6.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.92 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |