C31H22ClNO5 — CID 126182693
[(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126182693) has the molecular formula C31H22ClNO5 and a molecular weight of 523.97 g/mol. Its IUPAC name is [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126182693 |
| Molecular Formula | C31H22ClNO5 |
| Molecular Weight | 523.97 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | [(1R)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 2-(2,6-dimethylphenyl)-1,3-dioxoisoindole-5-carboxylate |
| SMILES | Cc1cccc(C)c1N1C(=O)c2ccc(C(=O)O[C@@H](C(=O)c3ccccc3)c3ccc(Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C31H22ClNO5/c1-18-7-6-8-19(2)26(18)33-29(35)24-16-13-22(17-25(24)30(33)36)31(37)38-28(21-11-14-23(32)15-12-21)27(34)20-9-4-3-5-10-20/h3-17,28H,1-2H3/t28-/m1/s1 |
| InChIKey | MVDULUKPTWXANA-MUUNZHRXSA-N |
| XLogP | 6.54 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.97 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|