C30H17ClF3NO5 — CID 126189298
[(1S)-2-oxo-1,2-diphenylethyl] 2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 126189298) has the molecular formula C30H17ClF3NO5 and a molecular weight of 563.92 g/mol. Its IUPAC name is [(1S)-2-oxo-1,2-diphenylethyl] 2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | [(1S)-2-oxo-1,2-diphenylethyl] 2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 126189298 |
| Molecular Formula | C30H17ClF3NO5 |
| Molecular Weight | 563.92 g/mol |
| Exact Mass | 563.07 |
| IUPAC Name | [(1S)-2-oxo-1,2-diphenylethyl] 2-[2-chloro-5-(trifluoromethyl)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(O[C@H](C(=O)c1ccccc1)c1ccccc1)c1ccc2c(c1)C(=O)N(c1cc(C(F)(F)F)ccc1Cl)C2=O |
| InChI | InChI=1S/C30H17ClF3NO5/c31-23-14-12-20(30(32,33)34)16-24(23)35-27(37)21-13-11-19(15-22(21)28(35)38)29(39)40-26(18-9-5-2-6-10-18)25(36)17-7-3-1-4-8-17/h1-16,26H/t26-/m0/s1 |
| InChIKey | RSCDQNDEPOJDKV-SANMLTNESA-N |
| XLogP | 6.94 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.92 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|