C30H20ClNO6 — CID 126181966
[(1R)-2-oxo-1,2-diphenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate (PubChem CID 126181966) has the molecular formula C30H20ClNO6 and a molecular weight of 525.94 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 126181966 |
| Molecular Formula | C30H20ClNO6 |
| Molecular Weight | 525.94 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 5-chloro-4-(1,3-dioxoisoindol-2-yl)-2-methoxybenzoate |
| SMILES | COc1cc(N2C(=O)c3ccccc3C2=O)c(Cl)cc1C(=O)O[C@@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H20ClNO6/c1-37-25-17-24(32-28(34)20-14-8-9-15-21(20)29(32)35)23(31)16-22(25)30(36)38-27(19-12-6-3-7-13-19)26(33)18-10-4-2-5-11-18/h2-17,27H,1H3/t27-/m1/s1 |
| InChIKey | AMHZUVLCNJCJNS-HHHXNRCGSA-N |
| XLogP | 5.93 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.94 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|