C23H20O4S — CID 2347509
[(1R)-2-oxo-1,2-diphenylethyl] 2-methoxy-4-methylsulfanylbenzoate (PubChem CID 2347509) has the molecular formula C23H20O4S and a molecular weight of 392.48 g/mol. Its IUPAC name is [(1R)-2-oxo-1,2-diphenylethyl] 2-methoxy-4-methylsulfanylbenzoate.
| Compound Name | [(1R)-2-oxo-1,2-diphenylethyl] 2-methoxy-4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 2347509 |
| Molecular Formula | C23H20O4S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | [(1R)-2-oxo-1,2-diphenylethyl] 2-methoxy-4-methylsulfanylbenzoate |
| SMILES | COc1cc(SC)ccc1C(=O)O[C@@H](C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20O4S/c1-26-20-15-18(28-2)13-14-19(20)23(25)27-22(17-11-7-4-8-12-17)21(24)16-9-5-3-6-10-16/h3-15,22H,1-2H3/t22-/m1/s1 |
| InChIKey | HNDLJOXZLDQGAC-JOCHJYFZSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |