C30H19Cl2NO5 — CID 126183257
[(1R)-2-(4-methylphenyl)-2-oxo-1-phenylethyl] 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 126183257) has the molecular formula C30H19Cl2NO5 and a molecular weight of 544.39 g/mol. Its IUPAC name is [(1R)-2-(4-methylphenyl)-2-oxo-1-phenylethyl] 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(1R)-2-(4-methylphenyl)-2-oxo-1-phenylethyl] 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 126183257 |
| Molecular Formula | C30H19Cl2NO5 |
| Molecular Weight | 544.39 g/mol |
| Exact Mass | 543.06 |
| IUPAC Name | [(1R)-2-(4-methylphenyl)-2-oxo-1-phenylethyl] 3-(5,6-dichloro-1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | Cc1ccc(C(=O)[C@H](OC(=O)c2cccc(N3C(=O)c4cc(Cl)c(Cl)cc4C3=O)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H19Cl2NO5/c1-17-10-12-18(13-11-17)26(34)27(19-6-3-2-4-7-19)38-30(37)20-8-5-9-21(14-20)33-28(35)22-15-24(31)25(32)16-23(22)29(33)36/h2-16,27H,1H3/t27-/m1/s1 |
| InChIKey | AATMSESCGVVRKU-HHHXNRCGSA-N |
| XLogP | 6.88 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.39 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|