C24H21ClO5S — CID 126190062
[(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-(4-methylphenyl)sulfonylpropanoate (PubChem CID 126190062) has the molecular formula C24H21ClO5S and a molecular weight of 456.95 g/mol. Its IUPAC name is [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-(4-methylphenyl)sulfonylpropanoate.
| Compound Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-(4-methylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 126190062 |
| Molecular Formula | C24H21ClO5S |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | [(1S)-1-(4-chlorophenyl)-2-oxo-2-phenylethyl] 3-(4-methylphenyl)sulfonylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)O[C@H](C(=O)c2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21ClO5S/c1-17-7-13-21(14-8-17)31(28,29)16-15-22(26)30-24(19-9-11-20(25)12-10-19)23(27)18-5-3-2-4-6-18/h2-14,24H,15-16H2,1H3/t24-/m0/s1 |
| InChIKey | SVVHFYPNBPAYAD-DEOSSOPVSA-N |
| XLogP | 4.98 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |