C23H22N2O5 — CID 7435756
[(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate (PubChem CID 7435756) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is [(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | [(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 7435756 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [(1R)-2-(cyclopentylamino)-2-oxo-1-phenylethyl] 2-(1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)O[C@@H](C(=O)NC1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H22N2O5/c26-19(14-25-22(28)17-12-6-7-13-18(17)23(25)29)30-20(15-8-2-1-3-9-15)21(27)24-16-10-4-5-11-16/h1-3,6-9,12-13,16,20H,4-5,10-11,14H2,(H,24,27)/t20-/m1/s1 |
| InChIKey | BRIONSAGLPRCLK-HXUWFJFHSA-N |
| XLogP | 2.63 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|