C15H8Br2N2O5 — CID 1242292
(2,6-dibromo-4-cyanophenyl) 2-(4-nitrophenoxy)acetate (PubChem CID 1242292) has the molecular formula C15H8Br2N2O5 and a molecular weight of 456.05 g/mol. Its IUPAC name is (2,6-dibromo-4-cyanophenyl) 2-(4-nitrophenoxy)acetate.
| Compound Name | (2,6-dibromo-4-cyanophenyl) 2-(4-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 1242292 |
| Molecular Formula | C15H8Br2N2O5 |
| Molecular Weight | 456.05 g/mol |
| Exact Mass | 453.88 |
| IUPAC Name | (2,6-dibromo-4-cyanophenyl) 2-(4-nitrophenoxy)acetate |
| SMILES | N#Cc1cc(Br)c(OC(=O)COc2ccc([N+](=O)[O-])cc2)c(Br)c1 |
| InChI | InChI=1S/C15H8Br2N2O5/c16-12-5-9(7-18)6-13(17)15(12)24-14(20)8-23-11-3-1-10(2-4-11)19(21)22/h1-6H,8H2 |
| InChIKey | ZHIPBIAWYHLLLQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 102.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.05 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|