C15H8Br3NO3 — CID 4247718
(2,6-dibromo-4-cyanophenyl) 2-(4-bromophenoxy)acetate (PubChem CID 4247718) has the molecular formula C15H8Br3NO3 and a molecular weight of 489.95 g/mol. Its IUPAC name is (2,6-dibromo-4-cyanophenyl) 2-(4-bromophenoxy)acetate.
| Compound Name | (2,6-dibromo-4-cyanophenyl) 2-(4-bromophenoxy)acetate |
|---|---|
| PubChem CID | 4247718 |
| Molecular Formula | C15H8Br3NO3 |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 486.81 |
| IUPAC Name | (2,6-dibromo-4-cyanophenyl) 2-(4-bromophenoxy)acetate |
| SMILES | N#Cc1cc(Br)c(OC(=O)COc2ccc(Br)cc2)c(Br)c1 |
| InChI | InChI=1S/C15H8Br3NO3/c16-10-1-3-11(4-2-10)21-8-14(20)22-15-12(17)5-9(7-19)6-13(15)18/h1-6H,8H2 |
| InChIKey | LGRGNQRXXYANDJ-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|