C18H10N6O10S4 — CID 54743920
(2Z)-2-hydroxy-N-(6-nitro-1,3-benzothiazol-2-yl)-2-(8-nitro-2,2,4-trioxo-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-3-ylidene)ethanesulfonamide (PubChem CID 54743920) has the molecular formula C18H10N6O10S4 and a molecular weight of 598.58 g/mol. Its IUPAC name is (2Z)-2-hydroxy-N-(6-nitro-1,3-benzothiazol-2-yl)-2-(8-nitro-2,2,4-trioxo-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-3-ylidene)ethanesulfonamide.
| Compound Name | (2Z)-2-hydroxy-N-(6-nitro-1,3-benzothiazol-2-yl)-2-(8-nitro-2,2,4-trioxo-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-3-ylidene)ethanesulfonamide |
|---|---|
| PubChem CID | 54743920 |
| Molecular Formula | C18H10N6O10S4 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 597.93 |
| IUPAC Name | (2Z)-2-hydroxy-N-(6-nitro-1,3-benzothiazol-2-yl)-2-(8-nitro-2,2,4-trioxo-[1,2,4]thiadiazino[3,4-b][1,3]benzothiazol-3-ylidene)ethanesulfonamide |
| SMILES | O=C1/C(=C(/O)CS(=O)(=O)Nc2nc3ccc([N+](=O)[O-])cc3s2)S(=O)(=O)N=C2Sc3cc([N+](=O)[O-])ccc3N12 |
| InChI | InChI=1S/C18H10N6O10S4/c25-12(7-37(31,32)20-17-19-10-3-1-8(23(27)28)5-13(10)35-17)15-16(26)22-11-4-2-9(24(29)30)6-14(11)36-18(22)21-38(15,33)34/h1-6,25H,7H2,(H,19,20)/b15-12- |
| InChIKey | LIVFZODFOBSWFM-QINSGFPZSA-N |
| XLogP | 2.46 |
| TPSA | 232.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|