C17H15N5O2S — CID 56575994
N-[3-(benzimidazol-1-yl)propyl]-6-nitro-1,3-benzothiazol-2-amine (PubChem CID 56575994) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-6-nitro-1,3-benzothiazol-2-amine.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-6-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 56575994 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-6-nitro-1,3-benzothiazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCCCn3cnc4ccccc43)sc2c1 |
| InChI | InChI=1S/C17H15N5O2S/c23-22(24)12-6-7-14-16(10-12)25-17(20-14)18-8-3-9-21-11-19-13-4-1-2-5-15(13)21/h1-2,4-7,10-11H,3,8-9H2,(H,18,20) |
| InChIKey | RTDKEAVXHFYHSV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|