C14H11N3O4S2 — CID 8603504
N-(2-methyl-1,3-benzothiazol-6-yl)-2-nitrobenzenesulfonamide (PubChem CID 8603504) has the molecular formula C14H11N3O4S2 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-(2-methyl-1,3-benzothiazol-6-yl)-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 8603504 |
| Molecular Formula | C14H11N3O4S2 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(2-methyl-1,3-benzothiazol-6-yl)-2-nitrobenzenesulfonamide |
| SMILES | Cc1nc2ccc(NS(=O)(=O)c3ccccc3[N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H11N3O4S2/c1-9-15-11-7-6-10(8-13(11)22-9)16-23(20,21)14-5-3-2-4-12(14)17(18)19/h2-8,16H,1H3 |
| InChIKey | BIBAXYJQWIOKTA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|