C16H16N2O4S3 — CID 50839837
N-(2-methylsulfonyl-1,3-benzothiazol-6-yl)-2-phenylethanesulfonamide (PubChem CID 50839837) has the molecular formula C16H16N2O4S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(2-methylsulfonyl-1,3-benzothiazol-6-yl)-2-phenylethanesulfonamide.
| Compound Name | N-(2-methylsulfonyl-1,3-benzothiazol-6-yl)-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 50839837 |
| Molecular Formula | C16H16N2O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-(2-methylsulfonyl-1,3-benzothiazol-6-yl)-2-phenylethanesulfonamide |
| SMILES | CS(=O)(=O)c1nc2ccc(NS(=O)(=O)CCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C16H16N2O4S3/c1-24(19,20)16-17-14-8-7-13(11-15(14)23-16)18-25(21,22)10-9-12-5-3-2-4-6-12/h2-8,11,18H,9-10H2,1H3 |
| InChIKey | ZBURVHTXDCJZBX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |