C16H14N2O2S2 — CID 8603510
(E)-N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylethenesulfonamide (PubChem CID 8603510) has the molecular formula C16H14N2O2S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (E)-N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylethenesulfonamide.
| Compound Name | (E)-N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylethenesulfonamide |
|---|---|
| PubChem CID | 8603510 |
| Molecular Formula | C16H14N2O2S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | (E)-N-(2-methyl-1,3-benzothiazol-6-yl)-2-phenylethenesulfonamide |
| SMILES | Cc1nc2ccc(NS(=O)(=O)/C=C/c3ccccc3)cc2s1 |
| InChI | InChI=1S/C16H14N2O2S2/c1-12-17-15-8-7-14(11-16(15)21-12)18-22(19,20)10-9-13-5-3-2-4-6-13/h2-11,18H,1H3/b10-9+ |
| InChIKey | MAZWIQMCIRIBGT-MDZDMXLPSA-N |
| XLogP | 4.02 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |