C16H15N3O2S — CID 8853021
1-(2-methoxyphenyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea (PubChem CID 8853021) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea.
| Compound Name | 1-(2-methoxyphenyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
|---|---|
| PubChem CID | 8853021 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(2-methyl-1,3-benzothiazol-6-yl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C16H15N3O2S/c1-10-17-13-8-7-11(9-15(13)22-10)18-16(20)19-12-5-3-4-6-14(12)21-2/h3-9H,1-2H3,(H2,18,19,20) |
| InChIKey | CRWSWKBXLIAFLE-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |