C17H17N3O2S — CID 17383803
1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)urea (PubChem CID 17383803) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)urea.
| Compound Name | 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 17383803 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(5,6-dimethyl-1,3-benzothiazol-2-yl)-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1nc2cc(C)c(C)cc2s1 |
| InChI | InChI=1S/C17H17N3O2S/c1-10-8-13-15(9-11(10)2)23-17(19-13)20-16(21)18-12-6-4-5-7-14(12)22-3/h4-9H,1-3H3,(H2,18,19,20,21) |
| InChIKey | IIUOBMQRQQYBFV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |