C16H15N3O2S2 — CID 121081206
1-(2-methoxyphenyl)-3-(4-methylsulfanyl-1,3-benzothiazol-2-yl)urea (PubChem CID 121081206) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-3-(4-methylsulfanyl-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(2-methoxyphenyl)-3-(4-methylsulfanyl-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121081206 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 1-(2-methoxyphenyl)-3-(4-methylsulfanyl-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccccc1NC(=O)Nc1nc2c(SC)cccc2s1 |
| InChI | InChI=1S/C16H15N3O2S2/c1-21-11-7-4-3-6-10(11)17-15(20)19-16-18-14-12(22-2)8-5-9-13(14)23-16/h3-9H,1-2H3,(H2,17,18,19,20) |
| InChIKey | OLRIQEYBEBPCJA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |