C15H10F2N2OS2 — CID 7615215
2,6-difluoro-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 7615215) has the molecular formula C15H10F2N2OS2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 2,6-difluoro-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 2,6-difluoro-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 7615215 |
| Molecular Formula | C15H10F2N2OS2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2,6-difluoro-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CSc1cccc2sc(NC(=O)c3c(F)cccc3F)nc12 |
| InChI | InChI=1S/C15H10F2N2OS2/c1-21-10-6-3-7-11-13(10)18-15(22-11)19-14(20)12-8(16)4-2-5-9(12)17/h2-7H,1H3,(H,18,19,20) |
| InChIKey | GIHOGAZYRQNDOJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |