C17H17N3O4S — CID 121080247
1-(2,4-dimethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 121080247) has the molecular formula C17H17N3O4S and a molecular weight of 359.41 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121080247 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | COc1ccc(NC(=O)Nc2nc3c(OC)cccc3s2)c(OC)c1 |
| InChI | InChI=1S/C17H17N3O4S/c1-22-10-7-8-11(13(9-10)24-3)18-16(21)20-17-19-15-12(23-2)5-4-6-14(15)25-17/h4-9H,1-3H3,(H2,18,19,20,21) |
| InChIKey | CEBRJYXYPTXULB-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |