C17H17N3O3S — CID 121080246
1-(4-ethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea (PubChem CID 121080246) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(4-ethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 121080246 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 1-(4-ethoxyphenyl)-3-(4-methoxy-1,3-benzothiazol-2-yl)urea |
| SMILES | CCOc1ccc(NC(=O)Nc2nc3c(OC)cccc3s2)cc1 |
| InChI | InChI=1S/C17H17N3O3S/c1-3-23-12-9-7-11(8-10-12)18-16(21)20-17-19-15-13(22-2)5-4-6-14(15)24-17/h4-10H,3H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | REPNXMRYBUSFTE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |